Compound Angles and 3D Trigonometry

25 min
0/3 practice checks

Compound-angle identities

cos(AB)=cosAcosB+sinAsinBcos(A+B)=cosAcosBsinAsinB\cos(A-B) = \cos A\cos B + \sin A\sin B \qquad \cos(A+B) = \cos A\cos B - \sin A\sin B
sin(A+B)=sinAcosB+cosAsinBsin(AB)=sinAcosBcosAsinB\sin(A+B) = \sin A\cos B + \cos A\sin B \qquad \sin(A-B) = \sin A\cos B - \cos A\sin B

Putting B=AB = A gives the double-angle formulae:

sin2A=2sinAcosA,cos2A=cos2Asin2A=12sin2A=2cos2A1\sin 2A = 2\sin A\cos A, \qquad \cos 2A = \cos^2 A - \sin^2 A = 1 - 2\sin^2 A = 2\cos^2 A - 1

Worked example: an exact value

cos15=cos(4530)=cos45cos30+sin45sin30=2232+2212=6+24\cos 15^\circ = \cos(45^\circ - 30^\circ) = \cos 45^\circ\cos 30^\circ + \sin 45^\circ\sin 30^\circ = \frac{\sqrt2}{2}\cdot\frac{\sqrt3}{2} + \frac{\sqrt2}{2}\cdot\frac12 = \frac{\sqrt6 + \sqrt2}{4}

Numerically that is 0,966\approx 0{,}966, which matches cos15\cos 15^\circ on a calculator.

Three-dimensional problems

In a 3D sketch, first identify the right-angled triangle in a vertical plane and the triangle in the horizontal plane, then link them by a shared side.

Worked example: a cellphone mast

A mast PQPQ stands vertically at PP. From a point AA on level ground, PA=40PA = 40 m and the angle of elevation of the top QQ is 3232^\circ. In right-angled APQ\triangle APQ:

tan32=PQ40    PQ=40tan3240(0,6249)25,0 m\tan 32^\circ = \frac{PQ}{40} \implies PQ = 40\tan 32^\circ \approx 40(0{,}6249) \approx 25{,}0\ \text{m}

When the horizontal triangle is not right-angled, use the tools you already know:

asinA=bsinB,a2=b2+c22bccosA,Area=12bcsinA\frac{a}{\sin A} = \frac{b}{\sin B}, \qquad a^2 = b^2 + c^2 - 2bc\cos A, \qquad \text{Area} = \tfrac12 bc\sin A

Simplify sin(90+x)\sin(90^\circ + x) using a compound-angle identity.

A solar panel is tilted at an angle θ\theta where sinθ=35\sin\theta = \dfrac{3}{5} and θ\theta is acute. Calculate the value of sin2θ\sin 2\theta as a decimal.

Two Eskom pylons BB and CC stand on level ground and are viewed from a substation at AA. The horizontal distances are AB=12AB = 12 m and AC=15AC = 15 m, with BA^C=60B\hat{A}C = 60^\circ. Calculate the distance BCBC in metres, correct to two decimal places.